C23H38N6O — CID 172659612
(3aR,5R,6R,7aS)-2-[2-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-4-yl]-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172659612) has the molecular formula C23H38N6O and a molecular weight of 414.60 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[2-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-4-yl]-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[2-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-4-yl]-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172659612 |
| Molecular Formula | C23H38N6O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[2-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-4-yl]-6-(4-methylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(c4nc(N(C)C)nc5c4CCCC5)C[C@@H]3C[C@H]2O)CC1 |
| InChI | InChI=1S/C23H38N6O/c1-26(2)23-24-19-7-5-4-6-18(19)22(25-23)29-14-16-12-20(21(30)13-17(16)15-29)28-10-8-27(3)9-11-28/h16-17,20-21,30H,4-15H2,1-3H3/t16-,17+,20-,21-/m1/s1 |
| InChIKey | NKCQSZWZPQVRPW-HRQSHJORSA-N |
| XLogP | 1.24 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |