C17H24F3N5O2 — CID 172660141
N-[(3aS,5R,6R,7aR)-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172660141) has the molecular formula C17H24F3N5O2 and a molecular weight of 387.41 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172660141 |
| Molecular Formula | C17H24F3N5O2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CCNc1nc(N2C[C@H]3C[C@@H](NC(C)=O)[C@H](O)C[C@H]3C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H24F3N5O2/c1-3-21-16-23-14(17(18,19)20)6-15(24-16)25-7-10-4-12(22-9(2)26)13(27)5-11(10)8-25/h6,10-13,27H,3-5,7-8H2,1-2H3,(H,22,26)(H,21,23,24)/t10-,11+,12-,13-/m1/s1 |
| InChIKey | JPLWZYDZJZMUAH-YVECIDJPSA-N |
| XLogP | 1.64 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |