C18H26F3N5O — CID 172660202
(3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172660202) has the molecular formula C18H26F3N5O and a molecular weight of 385.43 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172660202 |
| Molecular Formula | C18H26F3N5O |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(c4ccnc(C(F)(F)F)n4)C[C@@H]3C[C@H]2O)CC1 |
| InChI | InChI=1S/C18H26F3N5O/c1-24-4-6-25(7-5-24)14-8-12-10-26(11-13(12)9-15(14)27)16-2-3-22-17(23-16)18(19,20)21/h2-3,12-15,27H,4-11H2,1H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | FSTOLYSJZGZMLI-LXTVHRRPSA-N |
| XLogP | 1.32 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |