C24H30N2O2S — CID 172660594
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methylsulfanylbenzamide (PubChem CID 172660594) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methylsulfanylbenzamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 172660594 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)N[C@H]2C[C@H]3CN(CCc4ccccc4)C[C@H]3C[C@@H]2O)cc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-29-21-9-7-18(8-10-21)24(28)25-22-13-19-15-26(16-20(19)14-23(22)27)12-11-17-5-3-2-4-6-17/h2-10,19-20,22-23,27H,11-16H2,1H3,(H,25,28)/t19-,20+,22-,23-/m0/s1 |
| InChIKey | GKFARRCGUVNYFK-MQFRRQCYSA-N |
| XLogP | 3.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |