C16H22N6O3 — CID 172661873
(3aR,5R,6R,7aS)-2-(2,6-dimethoxypyrimidin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172661873) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-(2,6-dimethoxypyrimidin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-(2,6-dimethoxypyrimidin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172661873 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-(2,6-dimethoxypyrimidin-4-yl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | COc1cc(N2C[C@H]3C[C@@H](n4cncn4)[C@H](O)C[C@H]3C2)nc(OC)n1 |
| InChI | InChI=1S/C16H22N6O3/c1-24-15-5-14(19-16(20-15)25-2)21-6-10-3-12(22-9-17-8-18-22)13(23)4-11(10)7-21/h5,8-13,23H,3-4,6-7H2,1-2H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | KLGLSHOOXWQCSB-YVECIDJPSA-N |
| XLogP | 0.53 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |