C18H21FN4O2 — CID 172662651
[(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-fluoro-5-methylphenyl)methanone (PubChem CID 172662651) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-fluoro-5-methylphenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-fluoro-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 172662651 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-fluoro-5-methylphenyl)methanone |
| SMILES | Cc1cc(F)cc(C(=O)N2C[C@H]3C[C@@H](n4cncn4)[C@H](O)C[C@H]3C2)c1 |
| InChI | InChI=1S/C18H21FN4O2/c1-11-2-12(4-15(19)3-11)18(25)22-7-13-5-16(23-10-20-9-21-23)17(24)6-14(13)8-22/h2-4,9-10,13-14,16-17,24H,5-8H2,1H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | JEUSDVNZJDVJHN-YALNPMBYSA-N |
| XLogP | 1.81 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |