C17H22ClN5O2S — CID 172663263
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(1-methyltriazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorothiophene-2-carboxamide (PubChem CID 172663263) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(1-methyltriazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorothiophene-2-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(1-methyltriazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 172663263 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-[(1-methyltriazol-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorothiophene-2-carboxamide |
| SMILES | Cn1cc(CN2C[C@H]3C[C@H](O)[C@@H](NC(=O)c4sccc4Cl)C[C@H]3C2)nn1 |
| InChI | InChI=1S/C17H22ClN5O2S/c1-22-8-12(20-21-22)9-23-6-10-4-14(15(24)5-11(10)7-23)19-17(25)16-13(18)2-3-26-16/h2-3,8,10-11,14-15,24H,4-7,9H2,1H3,(H,19,25)/t10-,11+,14-,15-/m0/s1 |
| InChIKey | KPKUFZQGOLFVDU-JLUCKKNBSA-N |
| XLogP | 1.53 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |