C22H22N6OS — CID 172663748
(1R,9S)-11-(2,1,3-benzothiadiazol-5-ylmethyl)-5-(1-methylimidazol-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172663748) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is (1R,9S)-11-(2,1,3-benzothiadiazol-5-ylmethyl)-5-(1-methylimidazol-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-(2,1,3-benzothiadiazol-5-ylmethyl)-5-(1-methylimidazol-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172663748 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (1R,9S)-11-(2,1,3-benzothiadiazol-5-ylmethyl)-5-(1-methylimidazol-2-yl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cn1ccnc1-c1ccc2n(c1=O)C[C@H]1C[C@@H]2CN(Cc2ccc3nsnc3c2)C1 |
| InChI | InChI=1S/C22H22N6OS/c1-26-7-6-23-21(26)17-3-5-20-16-8-15(12-28(20)22(17)29)11-27(13-16)10-14-2-4-18-19(9-14)25-30-24-18/h2-7,9,15-16H,8,10-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | CTAGGGAMBKPBES-JKSUJKDBSA-N |
| XLogP | 2.87 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |