C23H19ClN2O4 — CID 17266404
(E)-3-[5-[(3-chlorophenoxy)methyl]furan-2-yl]-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 17266404) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is (E)-3-[5-[(3-chlorophenoxy)methyl]furan-2-yl]-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[(3-chlorophenoxy)methyl]furan-2-yl]-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 17266404 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (E)-3-[5-[(3-chlorophenoxy)methyl]furan-2-yl]-2-cyano-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C(C#N)=C/c2ccc(COc3cccc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C23H19ClN2O4/c1-28-19-7-5-16(6-8-19)14-26-23(27)17(13-25)11-21-9-10-22(30-21)15-29-20-4-2-3-18(24)12-20/h2-12H,14-15H2,1H3,(H,26,27)/b17-11+ |
| InChIKey | YVTBXZMJVVDDNU-GZTJUZNOSA-N |
| XLogP | 4.74 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|