C25H26N4O2 — CID 172664204
[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[6-(1-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl)naphthalen-2-yl]methanone (PubChem CID 172664204) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[6-(1-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl)naphthalen-2-yl]methanone.
| Compound Name | [(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[6-(1-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 172664204 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-[6-(1-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl)naphthalen-2-yl]methanone |
| SMILES | CN1CCc2cc(-c3ccc4cc(C(=O)N5C[C@@H]6NCCO[C@@H]6C5)ccc4c3)cnc21 |
| InChI | InChI=1S/C25H26N4O2/c1-28-8-6-19-12-21(13-27-24(19)28)18-3-2-17-11-20(5-4-16(17)10-18)25(30)29-14-22-23(15-29)31-9-7-26-22/h2-5,10-13,22-23,26H,6-9,14-15H2,1H3/t22-,23+/m0/s1 |
| InChIKey | MGWZYAARENIHEY-XZOQPEGZSA-N |
| XLogP | 2.71 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |