C21H34N4O4 — CID 172665041
2-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide (PubChem CID 172665041) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 172665041 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CN2C[C@H]3C[C@@H](N4CCOCC4)[C@H](O)C[C@H]3C2)no1 |
| InChI | InChI=1S/C21H34N4O4/c1-21(2,3)18-10-19(23-29-18)22-20(27)13-24-11-14-8-16(17(26)9-15(14)12-24)25-4-6-28-7-5-25/h10,14-17,26H,4-9,11-13H2,1-3H3,(H,22,23,27)/t14-,15+,16-,17-/m1/s1 |
| InChIKey | BIMCWXYAFJHPMN-YYIAUSFCSA-N |
| XLogP | 1.31 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |