C19H22N4OS — CID 172665246
(3aR,5R,6R,7aS)-2-(1-benzothiophen-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172665246) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-(1-benzothiophen-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-(1-benzothiophen-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172665246 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-(1-benzothiophen-2-ylmethyl)-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3cc4ccccc4s3)C[C@H]2C[C@H]1n1cncn1 |
| InChI | InChI=1S/C19H22N4OS/c24-18-7-15-9-22(8-14(15)6-17(18)23-12-20-11-21-23)10-16-5-13-3-1-2-4-19(13)25-16/h1-5,11-12,14-15,17-18,24H,6-10H2/t14-,15+,17-,18-/m1/s1 |
| InChIKey | NJLQFIXVECYTJV-CYGHRXIMSA-N |
| XLogP | 2.94 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |