C24H26N2O5 — CID 172665507
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1,3-benzoxazol-2-yl)ethanone (PubChem CID 172665507) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1,3-benzoxazol-2-yl)ethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1,3-benzoxazol-2-yl)ethanone |
|---|---|
| PubChem CID | 172665507 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1,3-benzoxazol-2-yl)ethanone |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(C(=O)Cc3nc4ccccc4o3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H26N2O5/c1-29-20-8-4-5-9-21(20)30-22-11-16-14-26(13-15(16)10-18(22)27)24(28)12-23-25-17-6-2-3-7-19(17)31-23/h2-9,15-16,18,22,27H,10-14H2,1H3/t15-,16+,18+,22+/m0/s1 |
| InChIKey | GFNVECFSPFNJJB-FIQUECFISA-N |
| XLogP | 3.06 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |