C17H22N4O2S — CID 172665623
N-[(3aS,5R,6R,7aR)-6-hydroxy-2-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172665623) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-6-hydroxy-2-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-6-hydroxy-2-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172665623 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-6-hydroxy-2-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(c3ncnc4c(C)csc34)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C17H22N4O2S/c1-9-7-24-16-15(9)18-8-19-17(16)21-5-11-3-13(20-10(2)22)14(23)4-12(11)6-21/h7-8,11-14,23H,3-6H2,1-2H3,(H,20,22)/t11-,12+,13-,14-/m1/s1 |
| InChIKey | FJZSAAKKKIQRGR-XJFOESAGSA-N |
| XLogP | 1.71 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |