C23H26N4O2 — CID 172666057
(3aR,5R,6R,7aS)-2-[(4-phenoxyphenyl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172666057) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(4-phenoxyphenyl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(4-phenoxyphenyl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172666057 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(4-phenoxyphenyl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3ccc(Oc4ccccc4)cc3)C[C@H]2C[C@H]1n1cncn1 |
| InChI | InChI=1S/C23H26N4O2/c28-23-11-19-14-26(13-18(19)10-22(23)27-16-24-15-25-27)12-17-6-8-21(9-7-17)29-20-4-2-1-3-5-20/h1-9,15-16,18-19,22-23,28H,10-14H2/t18-,19+,22-,23-/m1/s1 |
| InChIKey | NSDQSBDRMMDPQG-IYRWYFENSA-N |
| XLogP | 3.51 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |