C21H26F3N3O — CID 172666377
(3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[8-(trifluoromethyl)quinolin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172666377) has the molecular formula C21H26F3N3O and a molecular weight of 393.45 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[8-(trifluoromethyl)quinolin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[8-(trifluoromethyl)quinolin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172666377 |
| Molecular Formula | C21H26F3N3O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[8-(trifluoromethyl)quinolin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CO[C@@H]1C[C@H]2CN(c3ccnc4c(C(F)(F)F)cccc34)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C21H26F3N3O/c1-26(2)18-9-13-11-27(12-14(13)10-19(18)28-3)17-7-8-25-20-15(17)5-4-6-16(20)21(22,23)24/h4-8,13-14,18-19H,9-12H2,1-3H3/t13-,14+,18-,19-/m1/s1 |
| InChIKey | NISFHEIIKVQDGU-GTYSZEQSSA-N |
| XLogP | 4.05 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |