C19H28N4O3 — CID 172666555
3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-4-methyl-1-piperidin-4-ylpyridin-2-one (PubChem CID 172666555) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-4-methyl-1-piperidin-4-ylpyridin-2-one.
| Compound Name | 3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-4-methyl-1-piperidin-4-ylpyridin-2-one |
|---|---|
| PubChem CID | 172666555 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-4-methyl-1-piperidin-4-ylpyridin-2-one |
| SMILES | Cc1ccn(C2CCNCC2)c(=O)c1C(=O)N1CCN2CCOCC2C1 |
| InChI | InChI=1S/C19H28N4O3/c1-14-4-7-23(15-2-5-20-6-3-15)19(25)17(14)18(24)22-9-8-21-10-11-26-13-16(21)12-22/h4,7,15-16,20H,2-3,5-6,8-13H2,1H3 |
| InChIKey | SQAWQQPEDPMEPL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |