C18H29N5O2 — CID 172667300
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-1H-pyrazol-5-yl)methanone (PubChem CID 172667300) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-1H-pyrazol-5-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 172667300 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(dimethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-1H-pyrazol-5-yl)methanone |
| SMILES | CN(C)[C@@H]1C[C@@H]2CN(C(=O)c3cc(N)n[nH]3)C[C@@H]2C[C@H]1OCC1CC1 |
| InChI | InChI=1S/C18H29N5O2/c1-22(2)15-5-12-8-23(18(24)14-7-17(19)21-20-14)9-13(12)6-16(15)25-10-11-3-4-11/h7,11-13,15-16H,3-6,8-10H2,1-2H3,(H3,19,20,21)/t12-,13+,15-,16-/m1/s1 |
| InChIKey | ZOYIYEPJXGRZPJ-OCVGTWLNSA-N |
| XLogP | 1.20 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |