C21H26FN3O3 — CID 172667879
N-[2-(2-fluorophenoxy)ethyl]-4-methyl-2-oxo-1-(piperidin-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 172667879) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-4-methyl-2-oxo-1-(piperidin-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-4-methyl-2-oxo-1-(piperidin-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172667879 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-4-methyl-2-oxo-1-(piperidin-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccn(CC2CCCNC2)c(=O)c1C(=O)NCCOc1ccccc1F |
| InChI | InChI=1S/C21H26FN3O3/c1-15-8-11-25(14-16-5-4-9-23-13-16)21(27)19(15)20(26)24-10-12-28-18-7-3-2-6-17(18)22/h2-3,6-8,11,16,23H,4-5,9-10,12-14H2,1H3,(H,24,26) |
| InChIKey | UWCHXWFRPYVIHF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|