C18H23ClN2O4 — CID 172668170
8-(5-chlorofuran-2-carbonyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 172668170) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 8-(5-chlorofuran-2-carbonyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | 8-(5-chlorofuran-2-carbonyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 172668170 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 8-(5-chlorofuran-2-carbonyl)-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | O=C(c1ccc(Cl)o1)N1CCC2(CC1)CC(CN1CCCC1)OC2=O |
| InChI | InChI=1S/C18H23ClN2O4/c19-15-4-3-14(25-15)16(22)21-9-5-18(6-10-21)11-13(24-17(18)23)12-20-7-1-2-8-20/h3-4,13H,1-2,5-12H2 |
| InChIKey | LOPJHUXKMASWHA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |