C22H27N3O4 — CID 172668626
(6R,7R,8aR)-N-(4-methyl-2-oxochromen-7-yl)-6-(2-methylpropyl)-4-oxo-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 172668626) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (6R,7R,8aR)-N-(4-methyl-2-oxochromen-7-yl)-6-(2-methylpropyl)-4-oxo-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (6R,7R,8aR)-N-(4-methyl-2-oxochromen-7-yl)-6-(2-methylpropyl)-4-oxo-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 172668626 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (6R,7R,8aR)-N-(4-methyl-2-oxochromen-7-yl)-6-(2-methylpropyl)-4-oxo-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H]3C[C@@H]4CNCC(=O)N4[C@@H]3CC(C)C)ccc12 |
| InChI | InChI=1S/C22H27N3O4/c1-12(2)6-18-17(9-15-10-23-11-20(26)25(15)18)22(28)24-14-4-5-16-13(3)7-21(27)29-19(16)8-14/h4-5,7-8,12,15,17-18,23H,6,9-11H2,1-3H3,(H,24,28)/t15-,17-,18-/m1/s1 |
| InChIKey | JRGFXTQQPBYFAR-KBAYOESNSA-N |
| XLogP | 2.27 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|