C23H29N3O — CID 172669025
(1R,9S)-5-[(3,3-dimethyl-1,4-dihydroisoquinolin-2-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172669025) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is (1R,9S)-5-[(3,3-dimethyl-1,4-dihydroisoquinolin-2-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-[(3,3-dimethyl-1,4-dihydroisoquinolin-2-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172669025 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (1R,9S)-5-[(3,3-dimethyl-1,4-dihydroisoquinolin-2-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CC1(C)Cc2ccccc2CN1Cc1ccc2n(c1=O)C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C23H29N3O/c1-23(2)10-17-5-3-4-6-18(17)14-25(23)15-19-7-8-21-20-9-16(11-24-12-20)13-26(21)22(19)27/h3-8,16,20,24H,9-15H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | IPEWIECVHVPKAJ-OXJNMPFZSA-N |
| XLogP | 2.89 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |