C15H20ClNO3 — CID 172669514
(3aR,5R,6R,7aS)-6-(2-chloro-4-methoxyphenoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ol (PubChem CID 172669514) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(2-chloro-4-methoxyphenoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(2-chloro-4-methoxyphenoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ol |
|---|---|
| PubChem CID | 172669514 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(2-chloro-4-methoxyphenoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ol |
| SMILES | COc1ccc(O[C@@H]2C[C@@H]3CNC[C@@H]3C[C@H]2O)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO3/c1-19-11-2-3-14(12(16)6-11)20-15-5-10-8-17-7-9(10)4-13(15)18/h2-3,6,9-10,13,15,17-18H,4-5,7-8H2,1H3/t9-,10+,13+,15+/m0/s1 |
| InChIKey | NAPDQPOGYSZCKB-LHAYTIOMSA-N |
| XLogP | 2.09 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |