C16H23FN4O2 — CID 172669562
N-[(3aS,5R,6R,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172669562) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172669562 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CCc1ncnc(N2C[C@H]3C[C@@H](NC(C)=O)[C@H](O)C[C@H]3C2)c1F |
| InChI | InChI=1S/C16H23FN4O2/c1-3-12-15(17)16(19-8-18-12)21-6-10-4-13(20-9(2)22)14(23)5-11(10)7-21/h8,10-11,13-14,23H,3-7H2,1-2H3,(H,20,22)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | XMGYVHUGEDFRFP-ZMJPVWNMSA-N |
| XLogP | 0.89 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |