C17H19N7O2 — CID 172669952
(5-methoxy-1-methyl-1,2,4-triazol-3-yl)-[(5S)-5-methyl-3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 172669952) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is (5-methoxy-1-methyl-1,2,4-triazol-3-yl)-[(5S)-5-methyl-3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (5-methoxy-1-methyl-1,2,4-triazol-3-yl)-[(5S)-5-methyl-3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 172669952 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (5-methoxy-1-methyl-1,2,4-triazol-3-yl)-[(5S)-5-methyl-3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | COc1nc(C(=O)N2Cc3nnc(-c4ccccc4)n3[C@@H](C)C2)nn1C |
| InChI | InChI=1S/C17H19N7O2/c1-11-9-23(16(25)14-18-17(26-3)22(2)21-14)10-13-19-20-15(24(11)13)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | FCBAHKBCHOUPKC-NSHDSACASA-N |
| XLogP | 1.30 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |