About 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium
5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium (PubChem CID 17267) has the molecular formula C9H17N2+
and a molecular weight of 153.25 g/mol. Its IUPAC name is 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium.
Molecular Properties
| Compound Name | 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium |
| PubChem CID | 17267 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium |
| SMILES | CN(C)C=CC=CC=[N+](C)C |
| InChI | InChI=1S/C9H17N2/c1-10(2)8-6-5-7-9-11(3)4/h5-9H,1-4H3/q+1 |
| InChIKey | JKZCMAGCABHBCV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium?
The IUPAC name of 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium (CID 17267) is 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium.
What is the SMILES notation for 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium?
The canonical SMILES for 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium is CN(C)C=CC=CC=[N+](C)C.
What is the InChIKey of 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium?
The InChIKey is JKZCMAGCABHBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N2/c1-10(2)8-6-5-7-9-11(3)4/h5-9H,1-4H3/q+1.
What are the key properties of 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium?
5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium has a molecular weight of 153.25 g/mol, XLogP of 0.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)penta-2,4-dienylidene-dimethylazanium is sourced from PubChem (CID 17267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).