C23H24FN3O3 — CID 172670316
1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2H-indazol-3-yl)ethanone (PubChem CID 172670316) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2H-indazol-3-yl)ethanone.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 172670316 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(4-fluorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2H-indazol-3-yl)ethanone |
| SMILES | O=C(Cc1[nH]nc2ccccc12)N1C[C@H]2C[C@@H](Oc3ccc(F)cc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C23H24FN3O3/c24-16-5-7-17(8-6-16)30-22-10-15-13-27(12-14(15)9-21(22)28)23(29)11-20-18-3-1-2-4-19(18)25-26-20/h1-8,14-15,21-22,28H,9-13H2,(H,25,26)/t14-,15+,21+,22+/m0/s1 |
| InChIKey | IMSSPWOWCQWYLZ-AWIYMXTFSA-N |
| XLogP | 2.92 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |