C18H20F4N4O2 — CID 172670763
(3aR,5R,6R,7aS)-6-(4-fluorophenoxy)-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172670763) has the molecular formula C18H20F4N4O2 and a molecular weight of 400.38 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(4-fluorophenoxy)-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(4-fluorophenoxy)-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172670763 |
| Molecular Formula | C18H20F4N4O2 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(4-fluorophenoxy)-2-[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | Cn1nc(C(F)(F)F)nc1N1C[C@H]2C[C@@H](Oc3ccc(F)cc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C18H20F4N4O2/c1-25-17(23-16(24-25)18(20,21)22)26-8-10-6-14(27)15(7-11(10)9-26)28-13-4-2-12(19)3-5-13/h2-5,10-11,14-15,27H,6-9H2,1H3/t10-,11+,14+,15+/m0/s1 |
| InChIKey | CKGHOWPAVLGWQR-RBDSIQFVSA-N |
| XLogP | 2.63 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |