C17H22N2O2 — CID 172671068
1-cyclopropyl-4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)pyridin-2-one (PubChem CID 172671068) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-cyclopropyl-4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)pyridin-2-one.
| Compound Name | 1-cyclopropyl-4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)pyridin-2-one |
|---|---|
| PubChem CID | 172671068 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-cyclopropyl-4-methyl-3-(2-propan-2-yl-2,5-dihydropyrrole-1-carbonyl)pyridin-2-one |
| SMILES | Cc1ccn(C2CC2)c(=O)c1C(=O)N1CC=CC1C(C)C |
| InChI | InChI=1S/C17H22N2O2/c1-11(2)14-5-4-9-19(14)17(21)15-12(3)8-10-18(16(15)20)13-6-7-13/h4-5,8,10-11,13-14H,6-7,9H2,1-3H3 |
| InChIKey | ASNISOLYCFKEDG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|