C18H20F2N4O3 — CID 172671550
(3aR,5R,6R,7aS)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172671550) has the molecular formula C18H20F2N4O3 and a molecular weight of 378.38 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172671550 |
| Molecular Formula | C18H20F2N4O3 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-6-(1,2,4-triazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3ccc4c(c3)OC(F)(F)O4)C[C@H]2C[C@H]1n1cncn1 |
| InChI | InChI=1S/C18H20F2N4O3/c19-18(20)26-16-2-1-11(3-17(16)27-18)6-23-7-12-4-14(24-10-21-9-22-24)15(25)5-13(12)8-23/h1-3,9-10,12-15,25H,4-8H2/t12-,13+,14-,15-/m1/s1 |
| InChIKey | YIHMDJZWRDBSRU-LXTVHRRPSA-N |
| XLogP | 2.04 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |