C21H25N3O3 — CID 172671826
[(3aR,5R,6R,7aS)-5-hydroxy-6-imidazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3,4-dihydro-2H-chromen-6-yl)methanone (PubChem CID 172671826) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-imidazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3,4-dihydro-2H-chromen-6-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-imidazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3,4-dihydro-2H-chromen-6-yl)methanone |
|---|---|
| PubChem CID | 172671826 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-imidazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3,4-dihydro-2H-chromen-6-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCCO2)N1C[C@H]2C[C@@H](n3ccnc3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C21H25N3O3/c25-19-10-17-12-24(11-16(17)9-18(19)23-6-5-22-13-23)21(26)15-3-4-20-14(8-15)2-1-7-27-20/h3-6,8,13,16-19,25H,1-2,7,9-12H2/t16-,17+,18-,19-/m1/s1 |
| InChIKey | ZGTQETCDBLQBND-FCGDIQPGSA-N |
| XLogP | 2.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |