C22H22N2O4 — CID 172672235
N-[2-(2-hydroxyethyl)phenyl]-1-(2-methoxyphenyl)-4-methyl-2-oxopyridine-3-carboxamide (PubChem CID 172672235) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)phenyl]-1-(2-methoxyphenyl)-4-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | N-[2-(2-hydroxyethyl)phenyl]-1-(2-methoxyphenyl)-4-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 172672235 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[2-(2-hydroxyethyl)phenyl]-1-(2-methoxyphenyl)-4-methyl-2-oxopyridine-3-carboxamide |
| SMILES | COc1ccccc1-n1ccc(C)c(C(=O)Nc2ccccc2CCO)c1=O |
| InChI | InChI=1S/C22H22N2O4/c1-15-11-13-24(18-9-5-6-10-19(18)28-2)22(27)20(15)21(26)23-17-8-4-3-7-16(17)12-14-25/h3-11,13,25H,12,14H2,1-2H3,(H,23,26) |
| InChIKey | PPVKIIMZDWUGTC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |