C22H29FN4O2 — CID 172672436
N-[(3aS,5R,6R,7aR)-2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172672436) has the molecular formula C22H29FN4O2 and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172672436 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-2-[[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(Cc3c(C)nn(-c4ccc(F)cc4)c3C)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C22H29FN4O2/c1-13-20(14(2)27(25-13)19-6-4-18(23)5-7-19)12-26-10-16-8-21(24-15(3)28)22(29)9-17(16)11-26/h4-7,16-17,21-22,29H,8-12H2,1-3H3,(H,24,28)/t16-,17+,21-,22-/m1/s1 |
| InChIKey | RWFZOSPLDJSQQD-WOSNLTMFSA-N |
| XLogP | 2.34 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |