C23H27FN2O4 — CID 172673693
3-[4-(2-fluorophenoxy)piperidine-1-carbonyl]-4-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one (PubChem CID 172673693) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-[4-(2-fluorophenoxy)piperidine-1-carbonyl]-4-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one.
| Compound Name | 3-[4-(2-fluorophenoxy)piperidine-1-carbonyl]-4-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 172673693 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[4-(2-fluorophenoxy)piperidine-1-carbonyl]-4-methyl-1-(oxolan-2-ylmethyl)pyridin-2-one |
| SMILES | Cc1ccn(CC2CCCO2)c(=O)c1C(=O)N1CCC(Oc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H27FN2O4/c1-16-8-11-26(15-18-5-4-14-29-18)23(28)21(16)22(27)25-12-9-17(10-13-25)30-20-7-3-2-6-19(20)24/h2-3,6-8,11,17-18H,4-5,9-10,12-15H2,1H3 |
| InChIKey | PPOTTWWDDWFHMX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |