C20H28N4O4S — CID 172674011
N-[(3aR,5S,6S,7aS)-2-ethylsulfonyl-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 172674011) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-2-ethylsulfonyl-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-2-ethylsulfonyl-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 172674011 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-2-ethylsulfonyl-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | CCS(=O)(=O)N1C[C@H]2C[C@H](OC)[C@@H](NC(=O)c3ccc4c(c3)ncn4C)C[C@H]2C1 |
| InChI | InChI=1S/C20H28N4O4S/c1-4-29(26,27)24-10-14-8-17(19(28-3)9-15(14)11-24)22-20(25)13-5-6-18-16(7-13)21-12-23(18)2/h5-7,12,14-15,17,19H,4,8-11H2,1-3H3,(H,22,25)/t14-,15+,17-,19-/m0/s1 |
| InChIKey | TVXOWOLZCJZHQP-HIRMHNASSA-N |
| XLogP | 1.38 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |