C21H21N3O — CID 172674466
6-(3,3-dimethylbut-1-ynyl)-N-(1H-imidazol-2-ylmethyl)naphthalene-2-carboxamide (PubChem CID 172674466) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 6-(3,3-dimethylbut-1-ynyl)-N-(1H-imidazol-2-ylmethyl)naphthalene-2-carboxamide.
| Compound Name | 6-(3,3-dimethylbut-1-ynyl)-N-(1H-imidazol-2-ylmethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 172674466 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 6-(3,3-dimethylbut-1-ynyl)-N-(1H-imidazol-2-ylmethyl)naphthalene-2-carboxamide |
| SMILES | CC(C)(C)C#Cc1ccc2cc(C(=O)NCc3ncc[nH]3)ccc2c1 |
| InChI | InChI=1S/C21H21N3O/c1-21(2,3)9-8-15-4-5-17-13-18(7-6-16(17)12-15)20(25)24-14-19-22-10-11-23-19/h4-7,10-13H,14H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | CDVDMOXKCMIGJN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|