C18H30O — CID 172675316
(4E,7Z)-6-methyl-8-[(1R,6R)-2,2,6-trimethylcyclohexyl]octa-4,7-dien-2-one (PubChem CID 172675316) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (4E,7Z)-6-methyl-8-[(1R,6R)-2,2,6-trimethylcyclohexyl]octa-4,7-dien-2-one.
| Compound Name | (4E,7Z)-6-methyl-8-[(1R,6R)-2,2,6-trimethylcyclohexyl]octa-4,7-dien-2-one |
|---|---|
| PubChem CID | 172675316 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (4E,7Z)-6-methyl-8-[(1R,6R)-2,2,6-trimethylcyclohexyl]octa-4,7-dien-2-one |
| SMILES | CC(=O)C/C=C/C(C)/C=C\[C@H]1[C@H](C)CCCC1(C)C |
| InChI | InChI=1S/C18H30O/c1-14(8-6-10-16(3)19)11-12-17-15(2)9-7-13-18(17,4)5/h6,8,11-12,14-15,17H,7,9-10,13H2,1-5H3/b8-6+,12-11-/t14?,15-,17+/m1/s1 |
| InChIKey | SJAFWLTZBBBFBP-HZEAKZNKSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|