C18H19ClF3N5O — CID 172675493
4-chloro-5-[3-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]diazinan-3-one (PubChem CID 172675493) has the molecular formula C18H19ClF3N5O and a molecular weight of 413.83 g/mol. Its IUPAC name is 4-chloro-5-[3-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[3-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]diazinan-3-one |
|---|---|
| PubChem CID | 172675493 |
| Molecular Formula | C18H19ClF3N5O |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-chloro-5-[3-[[2-(trifluoromethyl)phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]diazinan-3-one |
| SMILES | O=C1NNCC(N2CCn3c(Cc4ccccc4C(F)(F)F)cnc3C2)C1Cl |
| InChI | InChI=1S/C18H19ClF3N5O/c19-16-14(9-24-25-17(16)28)26-5-6-27-12(8-23-15(27)10-26)7-11-3-1-2-4-13(11)18(20,21)22/h1-4,8,14,16,24H,5-7,9-10H2,(H,25,28) |
| InChIKey | QIFHSEOBJJWNFH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|