C25H34F3N5O4 — CID 172675529
N-[(3S,7E,16S,19S,20R,22S)-16-cyano-21,21-dimethyl-2,13,18-trioxo-1,12,17-triazatricyclo[17.4.0.020,22]tricos-7-en-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 172675529) has the molecular formula C25H34F3N5O4 and a molecular weight of 525.57 g/mol. Its IUPAC name is N-[(3S,7E,16S,19S,20R,22S)-16-cyano-21,21-dimethyl-2,13,18-trioxo-1,12,17-triazatricyclo[17.4.0.020,22]tricos-7-en-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3S,7E,16S,19S,20R,22S)-16-cyano-21,21-dimethyl-2,13,18-trioxo-1,12,17-triazatricyclo[17.4.0.020,22]tricos-7-en-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 172675529 |
| Molecular Formula | C25H34F3N5O4 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N-[(3S,7E,16S,19S,20R,22S)-16-cyano-21,21-dimethyl-2,13,18-trioxo-1,12,17-triazatricyclo[17.4.0.020,22]tricos-7-en-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)[C@@H]2[C@H]3C(=O)N[C@H](C#N)CCC(=O)NCCC/C=C/CCC[C@H](NC(=O)C(F)(F)F)C(=O)N3C[C@@H]21 |
| InChI | InChI=1S/C25H34F3N5O4/c1-24(2)16-14-33-20(19(16)24)21(35)31-15(13-29)10-11-18(34)30-12-8-6-4-3-5-7-9-17(22(33)36)32-23(37)25(26,27)28/h3-4,15-17,19-20H,5-12,14H2,1-2H3,(H,30,34)(H,31,35)(H,32,37)/b4-3+/t15-,16-,17-,19-,20-/m0/s1 |
| InChIKey | KNQIPFWJUIHMDV-FXTNRTBESA-N |
| XLogP | 1.94 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|