C23H27F6N7O3 — CID 172675632
4-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]imino-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 172675632) has the molecular formula C23H27F6N7O3 and a molecular weight of 563.50 g/mol. Its IUPAC name is 4-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]imino-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]imino-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 172675632 |
| Molecular Formula | C23H27F6N7O3 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 4-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]imino-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3NCCC2C1)/N=C1\C=NNC(=O)C1C(F)(F)F |
| InChI | InChI=1S/C23H27F6N7O3/c1-13(33-17-10-32-34-21(38)19(17)23(27,28)29)12-39-7-3-18(37)35-5-6-36-15(11-35)2-4-30-16-8-14(22(24,25)26)9-31-20(16)36/h8-10,13,15,19,30H,2-7,11-12H2,1H3,(H,34,38)/b33-17+/t13-,15?,19?/m0/s1 |
| InChIKey | UVGSGQONEOCHKP-OUPTURIRSA-N |
| XLogP | 2.46 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|