About 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile
2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile (PubChem CID 172675740) has the molecular formula C13H11Cl2N3O3
and a molecular weight of 328.16 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 172675740 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile |
| SMILES | COCCNc1oc(-c2cc(Cl)cc(Cl)c2O)nc1C#N |
| InChI | InChI=1S/C13H11Cl2N3O3/c1-20-3-2-17-13-10(6-16)18-12(21-13)8-4-7(14)5-9(15)11(8)19/h4-5,17,19H,2-3H2,1H3 |
| InChIKey | DMPNNIRJZIOFMQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile (CID 172675740) is 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile is COCCNc1oc(-c2cc(Cl)cc(Cl)c2O)nc1C#N.
What is the InChIKey of 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile?
The InChIKey is DMPNNIRJZIOFMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N3O3/c1-20-3-2-17-13-10(6-16)18-12(21-13)8-4-7(14)5-9(15)11(8)19/h4-5,17,19H,2-3H2,1H3.
What are the key properties of 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile?
2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile has a molecular weight of 328.16 g/mol, XLogP of 3.28, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichloro-2-hydroxyphenyl)-5-(2-methoxyethylamino)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 172675740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).