C19H19ClN3O5S- — CID 172675764
2-[[5-[4-(4-chlorophenyl)piperidin-1-yl]sulfonylpyridine-2-carbonyl]amino]acetate (PubChem CID 172675764) has the molecular formula C19H19ClN3O5S- and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-[[5-[4-(4-chlorophenyl)piperidin-1-yl]sulfonylpyridine-2-carbonyl]amino]acetate.
| Compound Name | 2-[[5-[4-(4-chlorophenyl)piperidin-1-yl]sulfonylpyridine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 172675764 |
| Molecular Formula | C19H19ClN3O5S- |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 2-[[5-[4-(4-chlorophenyl)piperidin-1-yl]sulfonylpyridine-2-carbonyl]amino]acetate |
| SMILES | O=C([O-])CNC(=O)c1ccc(S(=O)(=O)N2CCC(c3ccc(Cl)cc3)CC2)cn1 |
| InChI | InChI=1S/C19H20ClN3O5S/c20-15-3-1-13(2-4-15)14-7-9-23(10-8-14)29(27,28)16-5-6-17(21-11-16)19(26)22-12-18(24)25/h1-6,11,14H,7-10,12H2,(H,22,26)(H,24,25)/p-1 |
| InChIKey | HIWYRXWPCQHOSO-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |