C14H17N2O2- — CID 172675804
2-[(4aS,9bR)-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-8-yl]acetate (PubChem CID 172675804) has the molecular formula C14H17N2O2- and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-[(4aS,9bR)-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-8-yl]acetate.
| Compound Name | 2-[(4aS,9bR)-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-8-yl]acetate |
|---|---|
| PubChem CID | 172675804 |
| Molecular Formula | C14H17N2O2- |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[(4aS,9bR)-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-8-yl]acetate |
| SMILES | CN1CC[C@@H]2Nc3ccc(CC(=O)[O-])cc3[C@@H]2C1 |
| InChI | InChI=1S/C14H18N2O2/c1-16-5-4-13-11(8-16)10-6-9(7-14(17)18)2-3-12(10)15-13/h2-3,6,11,13,15H,4-5,7-8H2,1H3,(H,17,18)/p-1/t11-,13-/m0/s1 |
| InChIKey | ZFVURADTQOCIKU-AAEUAGOBSA-M |
| XLogP | 0.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |