C17H10N2O — CID 172676242
20-oxa-3,9-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (PubChem CID 172676242) has the molecular formula C17H10N2O and a molecular weight of 258.28 g/mol. Its IUPAC name is 20-oxa-3,9-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene.
| Compound Name | 20-oxa-3,9-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 172676242 |
| Molecular Formula | C17H10N2O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 20-oxa-3,9-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| SMILES | c1ccc2c(c1)oc1c2ccc2c1nc1ccccn12 |
| InChI | InChI=1S/C17H10N2O/c1-2-6-14-11(5-1)12-8-9-13-16(17(12)20-14)18-15-7-3-4-10-19(13)15/h1-10H |
| InChIKey | JRKAAYAQDMHZQN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |