C24H33NO3 — CID 172676331
methyl (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 172676331) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is methyl (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 172676331 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | methyl (4S)-2-[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@@H]1COC([C@]2(C)CCC[C@]3(C)c4ccc(C(C)C)cc4CC[C@@H]23)=N1 |
| InChI | InChI=1S/C24H33NO3/c1-15(2)16-7-9-18-17(13-16)8-10-20-23(18,3)11-6-12-24(20,4)22-25-19(14-28-22)21(26)27-5/h7,9,13,15,19-20H,6,8,10-12,14H2,1-5H3/t19-,20+,23+,24+/m0/s1 |
| InChIKey | LIERZXHTHNYJBC-HBUYNFGHSA-N |
| XLogP | 4.79 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |