C26H35N3O — CID 172676365
N-(1-adamantyl)-3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanamide (PubChem CID 172676365) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanamide.
| Compound Name | N-(1-adamantyl)-3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanamide |
|---|---|
| PubChem CID | 172676365 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N-(1-adamantyl)-3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanamide |
| SMILES | Cc1ccc2c(c1)c1c(n2CCC(=O)NC23CC4CC(CC(C4)C2)C3)CCN(C)C1 |
| InChI | InChI=1S/C26H35N3O/c1-17-3-4-23-21(9-17)22-16-28(2)7-5-24(22)29(23)8-6-25(30)27-26-13-18-10-19(14-26)12-20(11-18)15-26/h3-4,9,18-20H,5-8,10-16H2,1-2H3,(H,27,30) |
| InChIKey | YTVWYECXNNAKAR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|