C22H14N4O4 — CID 172676367
11-amino-15-(2-hydroxy-3-methoxyphenyl)-5-oxo-8-oxa-10,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaene-12-carbonitrile (PubChem CID 172676367) has the molecular formula C22H14N4O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 11-amino-15-(2-hydroxy-3-methoxyphenyl)-5-oxo-8-oxa-10,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaene-12-carbonitrile.
| Compound Name | 11-amino-15-(2-hydroxy-3-methoxyphenyl)-5-oxo-8-oxa-10,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaene-12-carbonitrile |
|---|---|
| PubChem CID | 172676367 |
| Molecular Formula | C22H14N4O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 11-amino-15-(2-hydroxy-3-methoxyphenyl)-5-oxo-8-oxa-10,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaene-12-carbonitrile |
| SMILES | COc1cccc(-c2cc3c4ccc(=O)cc4oc4nc(N)c(C#N)c([nH]2)c43)c1O |
| InChI | InChI=1S/C22H14N4O4/c1-29-16-4-2-3-12(20(16)28)15-8-13-11-6-5-10(27)7-17(11)30-22-18(13)19(25-15)14(9-23)21(24)26-22/h2-8,25,28H,1H3,(H2,24,26) |
| InChIKey | XRQHQSCFETZJAJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|