C34H53NO4 — CID 172676699
4-[[(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methoxy]-4-oxobutanoic acid (PubChem CID 172676699) has the molecular formula C34H53NO4 and a molecular weight of 539.80 g/mol. Its IUPAC name is 4-[[(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 172676699 |
| Molecular Formula | C34H53NO4 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | 4-[[(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methoxy]-4-oxobutanoic acid |
| SMILES | CC1(C)NCCC[C@]2(C)[C@H]3C=CC4=C5C[C@](C)(COC(=O)CCC(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C34H53NO4/c1-29(2)25-13-15-34(7)26(32(25,5)14-8-20-35-29)10-9-23-24-21-30(3,22-39-28(38)12-11-27(36)37)16-17-31(24,4)18-19-33(23,34)6/h9-10,25-26,35H,8,11-22H2,1-7H3,(H,36,37)/t25-,26+,30+,31+,32-,33+,34+/m0/s1 |
| InChIKey | NZQBWFZCDCEELQ-PZDDSDNGSA-N |
| XLogP | 7.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |