C17H26ClNO — CID 172676756
1-[3-[3-(4-chlorophenyl)propoxy]propyl]-2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine (PubChem CID 172676756) has the molecular formula C17H26ClNO and a molecular weight of 305.92 g/mol. Its IUPAC name is 1-[3-[3-(4-chlorophenyl)propoxy]propyl]-2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine.
| Compound Name | 1-[3-[3-(4-chlorophenyl)propoxy]propyl]-2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine |
|---|---|
| PubChem CID | 172676756 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 305.92 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 1-[3-[3-(4-chlorophenyl)propoxy]propyl]-2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine |
| SMILES | [2H]C1([2H])N(CCCOCCCc2ccc(Cl)cc2)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C17H26ClNO/c18-17-9-7-16(8-10-17)6-4-14-20-15-5-13-19-11-2-1-3-12-19/h7-10H,1-6,11-15H2/i1D2,2D2,3D2,11D2,12D2 |
| InChIKey | NNACHAUCXXVJSP-GQBOCPGDSA-N |
| XLogP | 4.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|