C28H32N2O10 — CID 172677385
N-hydroxy-2-[1-hydroxy-6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetamide (PubChem CID 172677385) has the molecular formula C28H32N2O10 and a molecular weight of 556.57 g/mol. Its IUPAC name is N-hydroxy-2-[1-hydroxy-6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetamide.
| Compound Name | N-hydroxy-2-[1-hydroxy-6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 172677385 |
| Molecular Formula | C28H32N2O10 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | N-hydroxy-2-[1-hydroxy-6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetamide |
| SMILES | COc1c(OCC(=O)NO)cc2oc3cc(OCC(=O)NO)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C28H32N2O10/c1-14(2)6-8-16-18(38-12-22(31)29-35)10-20-25(26(16)33)27(34)24-17(9-7-15(3)4)28(37-5)21(11-19(24)40-20)39-13-23(32)30-36/h6-7,10-11,33,35-36H,8-9,12-13H2,1-5H3,(H,29,31)(H,30,32) |
| InChIKey | YGXBEJKHNIMTHA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 176.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|